About 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid
2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 1473790) has the molecular formula C12H11NO4S
and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 1473790 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2nc(C(=O)O)cs2)cc1OC |
| InChI | InChI=1S/C12H11NO4S/c1-16-9-4-3-7(5-10(9)17-2)11-13-8(6-18-11)12(14)15/h3-6H,1-2H3,(H,14,15) |
| InChIKey | PGSGSXVGWCROPO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid (CID 1473790) is 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid is COc1ccc(-c2nc(C(=O)O)cs2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is PGSGSXVGWCROPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4S/c1-16-9-4-3-7(5-10(9)17-2)11-13-8(6-18-11)12(14)15/h3-6H,1-2H3,(H,14,15).
What are the key properties of 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 265.29 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 1473790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).