C31H34FNO2 — CID 147379199
1-[(4bS,7R,8aR)-4b-benzyl-7-(1-fluoroethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone (PubChem CID 147379199) has the molecular formula C31H34FNO2 and a molecular weight of 471.62 g/mol. Its IUPAC name is 1-[(4bS,7R,8aR)-4b-benzyl-7-(1-fluoroethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone.
| Compound Name | 1-[(4bS,7R,8aR)-4b-benzyl-7-(1-fluoroethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 147379199 |
| Molecular Formula | C31H34FNO2 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 1-[(4bS,7R,8aR)-4b-benzyl-7-(1-fluoroethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone |
| SMILES | Cc1ncccc1CC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(C(C)F)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C31H34FNO2/c1-21-24(9-6-16-33-21)18-29(34)26-11-13-28-25(17-26)10-12-27-20-31(35,22(2)32)15-14-30(27,28)19-23-7-4-3-5-8-23/h3-9,11,13,16-17,22,27,35H,10,12,14-15,18-20H2,1-2H3/t22?,27-,30+,31-/m1/s1 |
| InChIKey | DKPYPARLNWGKDN-KNNVEXGBSA-N |
| XLogP | 6.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |