C23H22F3N5O4 — CID 147379410
1-[1-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-5-oxopyrrolidin-3-yl]pyrrolidine-2,5-dione (PubChem CID 147379410) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is 1-[1-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-5-oxopyrrolidin-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-5-oxopyrrolidin-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 147379410 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-[1-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]-5-oxopyrrolidin-3-yl]pyrrolidine-2,5-dione |
| SMILES | C[C@H]1Cn2ncc(N3CC(N4C(=O)CCC4=O)CC3=O)c2CN1C(=O)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C23H22F3N5O4/c1-12-9-30-18(11-28(12)21(34)6-13-4-15(24)23(26)16(25)5-13)17(8-27-30)29-10-14(7-22(29)35)31-19(32)2-3-20(31)33/h4-5,8,12,14H,2-3,6-7,9-11H2,1H3/t12-,14?/m0/s1 |
| InChIKey | DKRAKBWGYQLDCL-NBFOIZRFSA-N |
| XLogP | 1.53 |
| TPSA | 95.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|