C23H20N4O4 — CID 14738262
(3aS,5S,7aR)-5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-phenyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 14738262) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is (3aS,5S,7aR)-5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-phenyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,5S,7aR)-5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-phenyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 14738262 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3aS,5S,7aR)-5-(4-benzyl-3,5-dioxo-1,2,4-triazolidin-1-yl)-2-phenyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2C[C@H](n3[nH]c(=O)n(Cc4ccccc4)c3=O)C=C[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H20N4O4/c28-20-18-12-11-17(13-19(18)21(29)26(20)16-9-5-2-6-10-16)27-23(31)25(22(30)24-27)14-15-7-3-1-4-8-15/h1-12,17-19H,13-14H2,(H,24,30)/t17-,18-,19+/m1/s1 |
| InChIKey | QXBBICMSAFCPKV-QRVBRYPASA-N |
| XLogP | 1.69 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|