C19H14ClF2N5 — CID 147382915
10-chloro-4-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 147382915) has the molecular formula C19H14ClF2N5 and a molecular weight of 385.81 g/mol. Its IUPAC name is 10-chloro-4-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 10-chloro-4-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 147382915 |
| Molecular Formula | C19H14ClF2N5 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 10-chloro-4-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | Fc1ccc(F)c([C@H]2CCCN2c2ccn3nc4c(Cl)nccc4c3n2)c1 |
| InChI | InChI=1S/C19H14ClF2N5/c20-18-17-12(5-7-23-18)19-24-16(6-9-27(19)25-17)26-8-1-2-15(26)13-10-11(21)3-4-14(13)22/h3-7,9-10,15H,1-2,8H2/t15-/m1/s1 |
| InChIKey | DLIGYDQRXWAKEF-OAHLLOKOSA-N |
| XLogP | 4.55 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|