C24H28ClN7O4S — CID 147383974
4-[(1S)-1-[3-[[(2S,3R)-3-(5-chloropyrimidin-2-yl)butan-2-yl]sulfonylmethyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-4-yl]ethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 147383974) has the molecular formula C24H28ClN7O4S and a molecular weight of 546.05 g/mol. Its IUPAC name is 4-[(1S)-1-[3-[[(2S,3R)-3-(5-chloropyrimidin-2-yl)butan-2-yl]sulfonylmethyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-4-yl]ethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[(1S)-1-[3-[[(2S,3R)-3-(5-chloropyrimidin-2-yl)butan-2-yl]sulfonylmethyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-4-yl]ethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 147383974 |
| Molecular Formula | C24H28ClN7O4S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 4-[(1S)-1-[3-[[(2S,3R)-3-(5-chloropyrimidin-2-yl)butan-2-yl]sulfonylmethyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-4-yl]ethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cccc(-c2nnc(CS(=O)(=O)[C@@H](C)[C@H](C)c3ncc(Cl)cn3)n2[C@@H](C)c2c(C)noc2C)n1 |
| InChI | InChI=1S/C24H28ClN7O4S/c1-13(23-26-10-18(25)11-27-23)17(5)37(33,34)12-20-29-30-24(19-8-7-9-21(28-19)35-6)32(20)15(3)22-14(2)31-36-16(22)4/h7-11,13,15,17H,12H2,1-6H3/t13-,15-,17-/m0/s1 |
| InChIKey | DLNRSYXXEJYVCS-QRTARXTBSA-N |
| XLogP | 4.11 |
| TPSA | 138.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |