C52H33N3O — CID 147385970
2-[8-(9,9-diphenylfluoren-2-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 147385970) has the molecular formula C52H33N3O and a molecular weight of 715.86 g/mol. Its IUPAC name is 2-[8-(9,9-diphenylfluoren-2-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[8-(9,9-diphenylfluoren-2-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 147385970 |
| Molecular Formula | C52H33N3O |
| Molecular Weight | 715.86 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | 2-[8-(9,9-diphenylfluoren-2-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccc(-c5ccc6c(c5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)cc34)n2)cc1 |
| InChI | InChI=1S/C52H33N3O/c1-5-15-34(16-6-1)49-53-50(35-17-7-2-8-18-35)55-51(54-49)38-26-29-43-44-31-36(27-30-47(44)56-48(43)33-38)37-25-28-42-41-23-13-14-24-45(41)52(46(42)32-37,39-19-9-3-10-20-39)40-21-11-4-12-22-40/h1-33H |
| InChIKey | DLXBUVBARFHCRE-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.86 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |