C20H34O5 — CID 147387131
1-O-methyl 4-O-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanedioate (PubChem CID 147387131) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-O-methyl 4-O-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanedioate.
| Compound Name | 1-O-methyl 4-O-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanedioate |
|---|---|
| PubChem CID | 147387131 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-O-methyl 4-O-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanedioate |
| SMILES | C=C(C)C(=O)CC(C)(C)C(C)(C)OC(=O)C(C)(C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C20H34O5/c1-13(2)14(21)12-17(3,4)20(9,10)25-16(23)19(7,8)18(5,6)15(22)24-11/h1,12H2,2-11H3 |
| InChIKey | DMDAFTNZCKWEDY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|