C13H22O4 — CID 14739232
(2R,4R,5S,6S)-2-tert-butyl-4-methyl-6-[(E)-prop-1-enyl]-1,3-dioxane-5-carboxylic acid (PubChem CID 14739232) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2R,4R,5S,6S)-2-tert-butyl-4-methyl-6-[(E)-prop-1-enyl]-1,3-dioxane-5-carboxylic acid.
| Compound Name | (2R,4R,5S,6S)-2-tert-butyl-4-methyl-6-[(E)-prop-1-enyl]-1,3-dioxane-5-carboxylic acid |
|---|---|
| PubChem CID | 14739232 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2R,4R,5S,6S)-2-tert-butyl-4-methyl-6-[(E)-prop-1-enyl]-1,3-dioxane-5-carboxylic acid |
| SMILES | C/C=C/[C@@H]1O[C@H](C(C)(C)C)O[C@H](C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H22O4/c1-6-7-9-10(11(14)15)8(2)16-12(17-9)13(3,4)5/h6-10,12H,1-5H3,(H,14,15)/b7-6+/t8-,9+,10+,12-/m1/s1 |
| InChIKey | KTRCXDIYEKOPCM-RTVUKHBASA-N |
| XLogP | 2.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|