About 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide
1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide (PubChem CID 1473928) has the molecular formula C19H13F3N2O2
and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide |
| PubChem CID | 1473928 |
| Molecular Formula | C19H13F3N2O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1F)c1cccn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H13F3N2O2/c20-13-9-15(21)17(16(22)10-13)23-18(25)14-7-4-8-24(19(14)26)11-12-5-2-1-3-6-12/h1-10H,11H2,(H,23,25) |
| InChIKey | XRCTWEFGGNPOMD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide?
The IUPAC name of 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide (CID 1473928) is 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide.
What is the SMILES notation for 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide?
The canonical SMILES for 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide is O=C(Nc1c(F)cc(F)cc1F)c1cccn(Cc2ccccc2)c1=O.
What is the InChIKey of 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide?
The InChIKey is XRCTWEFGGNPOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N2O2/c20-13-9-15(21)17(16(22)10-13)23-18(25)14-7-4-8-24(19(14)26)11-12-5-2-1-3-6-12/h1-10H,11H2,(H,23,25).
What are the key properties of 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide?
1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide has a molecular weight of 358.32 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-oxo-N-(2,4,6-trifluorophenyl)pyridine-3-carboxamide is sourced from PubChem (CID 1473928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).