C21H20ClNO3 — CID 14739378
ethyl 1-[(2-chlorophenyl)methyl]-4-(4-methoxyphenyl)pyrrole-3-carboxylate (PubChem CID 14739378) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is ethyl 1-[(2-chlorophenyl)methyl]-4-(4-methoxyphenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[(2-chlorophenyl)methyl]-4-(4-methoxyphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 14739378 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl 1-[(2-chlorophenyl)methyl]-4-(4-methoxyphenyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccccc2Cl)cc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H20ClNO3/c1-3-26-21(24)19-14-23(12-16-6-4-5-7-20(16)22)13-18(19)15-8-10-17(25-2)11-9-15/h4-11,13-14H,3,12H2,1-2H3 |
| InChIKey | BMFFZUJALKWFKA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |