About 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one
1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one (PubChem CID 14739535) has the molecular formula C15H13ClN2O
and a molecular weight of 272.74 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one |
| PubChem CID | 14739535 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one |
| SMILES | CC1(C)C(=O)N(c2ccccc2Cl)c2ncccc21 |
| InChI | InChI=1S/C15H13ClN2O/c1-15(2)10-6-5-9-17-13(10)18(14(15)19)12-8-4-3-7-11(12)16/h3-9H,1-2H3 |
| InChIKey | JXHBTIPLDOLXBH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one?
The IUPAC name of 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one (CID 14739535) is 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one.
What is the SMILES notation for 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one?
The canonical SMILES for 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one is CC1(C)C(=O)N(c2ccccc2Cl)c2ncccc21.
What is the InChIKey of 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one?
The InChIKey is JXHBTIPLDOLXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2O/c1-15(2)10-6-5-9-17-13(10)18(14(15)19)12-8-4-3-7-11(12)16/h3-9H,1-2H3.
What are the key properties of 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one?
1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one has a molecular weight of 272.74 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)-3,3-dimethylpyrrolo[2,3-b]pyridin-2-one is sourced from PubChem (CID 14739535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).