2-(2-amino-3-pyridinyl)acetic acid

C7H8N2O2 — CID 14739552

IUPAC2-(2-amino-3-pyridinyl)acetic acid
SMILESNc1ncccc1CC(=O)O
InChIInChI=1S/C7H8N2O2/c8-7-5(4-6(10)11)2-1-3-9-7/h1-3H,4H2,(H2,8,9)(H,10,11)
InChIKeyXIOPEJHJRPVVDJ-UHFFFAOYSA-N
MW152.15 g/mol
LogP0.29
Rot. Bonds2

About 2-(2-amino-3-pyridinyl)acetic acid

2-(2-amino-3-pyridinyl)acetic acid (PubChem CID 14739552) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)acetic acid.

Molecular Properties

Compound Name2-(2-amino-3-pyridinyl)acetic acid
PubChem CID14739552
Molecular FormulaC7H8N2O2
Molecular Weight152.15 g/mol
Exact Mass152.06
IUPAC Name2-(2-amino-3-pyridinyl)acetic acid
SMILESNc1ncccc1CC(=O)O
InChIInChI=1S/C7H8N2O2/c8-7-5(4-6(10)11)2-1-3-9-7/h1-3H,4H2,(H2,8,9)(H,10,11)
InChIKeyXIOPEJHJRPVVDJ-UHFFFAOYSA-N
XLogP0.29
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.15
LogP ≤ 50.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2-amino-3-pyridinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-amino-3-pyridinyl)acetic acid?
The IUPAC name of 2-(2-amino-3-pyridinyl)acetic acid (CID 14739552) is 2-(2-amino-3-pyridinyl)acetic acid.
What is the SMILES notation for 2-(2-amino-3-pyridinyl)acetic acid?
The canonical SMILES for 2-(2-amino-3-pyridinyl)acetic acid is Nc1ncccc1CC(=O)O.
What is the InChIKey of 2-(2-amino-3-pyridinyl)acetic acid?
The InChIKey is XIOPEJHJRPVVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-7-5(4-6(10)11)2-1-3-9-7/h1-3H,4H2,(H2,8,9)(H,10,11).
What are the key properties of 2-(2-amino-3-pyridinyl)acetic acid?
2-(2-amino-3-pyridinyl)acetic acid has a molecular weight of 152.15 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-3-pyridinyl)acetic acid is sourced from PubChem (CID 14739552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).