C21H26F3NO5S — CID 147397736
3-[(E)-5-[(2R)-2-[3-(2,2-difluoroethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione (PubChem CID 147397736) has the molecular formula C21H26F3NO5S and a molecular weight of 461.50 g/mol. Its IUPAC name is 3-[(E)-5-[(2R)-2-[3-(2,2-difluoroethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione.
| Compound Name | 3-[(E)-5-[(2R)-2-[3-(2,2-difluoroethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147397736 |
| Molecular Formula | C21H26F3NO5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3-[(E)-5-[(2R)-2-[3-(2,2-difluoroethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione |
| SMILES | C[C@@H](CS(=O)(=O)CC/C=C/CC1CCC(=O)NC1=O)c1ccc(F)c(OCC(F)F)c1 |
| InChI | InChI=1S/C21H26F3NO5S/c1-14(16-6-8-17(22)18(11-16)30-12-19(23)24)13-31(28,29)10-4-2-3-5-15-7-9-20(26)25-21(15)27/h2-3,6,8,11,14-15,19H,4-5,7,9-10,12-13H2,1H3,(H,25,26,27)/b3-2+/t14-,15?/m0/s1 |
| InChIKey | DOCWUVQIFKTVKS-WDVJJYHLSA-N |
| XLogP | 3.38 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|