C18H30BF3O3 — CID 147398718
2-[4-(ethoxymethyl)-4-(3,3,3-trifluoropropyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 147398718) has the molecular formula C18H30BF3O3 and a molecular weight of 362.24 g/mol. Its IUPAC name is 2-[4-(ethoxymethyl)-4-(3,3,3-trifluoropropyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(ethoxymethyl)-4-(3,3,3-trifluoropropyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 147398718 |
| Molecular Formula | C18H30BF3O3 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[4-(ethoxymethyl)-4-(3,3,3-trifluoropropyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOCC1(CCC(F)(F)F)CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C18H30BF3O3/c1-6-23-13-17(11-12-18(20,21)22)9-7-14(8-10-17)19-24-15(2,3)16(4,5)25-19/h7H,6,8-13H2,1-5H3 |
| InChIKey | DOHXOVONDJONGB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|