C18H27NO5 — CID 147399980
7-tert-butyl-2-methoxy-3-(3-methoxypropoxy)-7,8-dihydro-6H-oxepino[3,2-b]pyridin-9-one (PubChem CID 147399980) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 7-tert-butyl-2-methoxy-3-(3-methoxypropoxy)-7,8-dihydro-6H-oxepino[3,2-b]pyridin-9-one.
| Compound Name | 7-tert-butyl-2-methoxy-3-(3-methoxypropoxy)-7,8-dihydro-6H-oxepino[3,2-b]pyridin-9-one |
|---|---|
| PubChem CID | 147399980 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 7-tert-butyl-2-methoxy-3-(3-methoxypropoxy)-7,8-dihydro-6H-oxepino[3,2-b]pyridin-9-one |
| SMILES | COCCCOc1cc2c(nc1OC)C(=O)CC(C(C)(C)C)CO2 |
| InChI | InChI=1S/C18H27NO5/c1-18(2,3)12-9-13(20)16-14(24-11-12)10-15(17(19-16)22-5)23-8-6-7-21-4/h10,12H,6-9,11H2,1-5H3 |
| InChIKey | DOOIASATFNIYEG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|