C33H31F2N2O+ — CID 147400902
2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium (PubChem CID 147400902) has the molecular formula C33H31F2N2O+ and a molecular weight of 509.62 g/mol. Its IUPAC name is 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium.
| Compound Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 147400902 |
| Molecular Formula | C33H31F2N2O+ |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium |
| SMILES | Cc1cc(F)c2c(oc3cc(F)ccc32)c1-c1n(-c2c(C(C)C)cccc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C33H31F2N2O/c1-18(2)22-10-9-11-23(19(3)4)31(22)37-27-13-8-7-12-26(27)36(6)33(37)29-20(5)16-25(35)30-24-15-14-21(34)17-28(24)38-32(29)30/h7-19H,1-6H3/q+1 |
| InChIKey | SMVDSQDKYIZNAF-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|