About ethyl 5-hydroxyhept-6-ynoate
ethyl 5-hydroxyhept-6-ynoate (PubChem CID 14740272) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is ethyl 5-hydroxyhept-6-ynoate.
Molecular Properties
| Compound Name | ethyl 5-hydroxyhept-6-ynoate |
| PubChem CID | 14740272 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | ethyl 5-hydroxyhept-6-ynoate |
| SMILES | C#CC(O)CCCC(=O)OCC |
| InChI | InChI=1S/C9H14O3/c1-3-8(10)6-5-7-9(11)12-4-2/h1,8,10H,4-7H2,2H3 |
| InChIKey | BLFAAZZKVRWRJT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hydroxyhept-6-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxyhept-6-ynoate?
The IUPAC name of ethyl 5-hydroxyhept-6-ynoate (CID 14740272) is ethyl 5-hydroxyhept-6-ynoate.
What is the SMILES notation for ethyl 5-hydroxyhept-6-ynoate?
The canonical SMILES for ethyl 5-hydroxyhept-6-ynoate is C#CC(O)CCCC(=O)OCC.
What is the InChIKey of ethyl 5-hydroxyhept-6-ynoate?
The InChIKey is BLFAAZZKVRWRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-3-8(10)6-5-7-9(11)12-4-2/h1,8,10H,4-7H2,2H3.
What are the key properties of ethyl 5-hydroxyhept-6-ynoate?
ethyl 5-hydroxyhept-6-ynoate has a molecular weight of 170.21 g/mol, XLogP of 0.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxyhept-6-ynoate is sourced from PubChem (CID 14740272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).