About [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate
[2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate (PubChem CID 1474043) has the molecular formula C16H9ClF2N2O2S
and a molecular weight of 366.78 g/mol. Its IUPAC name is [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate |
| PubChem CID | 1474043 |
| Molecular Formula | C16H9ClF2N2O2S |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate |
| SMILES | Cc1sc(-c2ccc(Cl)nc2)nc1OC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H9ClF2N2O2S/c1-8-14(21-15(24-8)9-2-5-13(17)20-7-9)23-16(22)11-4-3-10(18)6-12(11)19/h2-7H,1H3 |
| InChIKey | LZWUQOMXRRYAFQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate?
The IUPAC name of [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate (CID 1474043) is [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate.
What is the SMILES notation for [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate?
The canonical SMILES for [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate is Cc1sc(-c2ccc(Cl)nc2)nc1OC(=O)c1ccc(F)cc1F.
What is the InChIKey of [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate?
The InChIKey is LZWUQOMXRRYAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClF2N2O2S/c1-8-14(21-15(24-8)9-2-5-13(17)20-7-9)23-16(22)11-4-3-10(18)6-12(11)19/h2-7H,1H3.
What are the key properties of [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate?
[2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate has a molecular weight of 366.78 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-thiazol-4-yl] 2,4-difluorobenzoate is sourced from PubChem (CID 1474043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).