About 2-ethylhexanethioic S-acid
2-ethylhexanethioic S-acid (PubChem CID 14740452) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is 2-ethylhexanethioic S-acid.
Molecular Properties
| Compound Name | 2-ethylhexanethioic S-acid |
| PubChem CID | 14740452 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-ethylhexanethioic S-acid |
| SMILES | CCCCC(CC)C(=O)S |
| InChI | InChI=1S/C8H16OS/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | BUOQFXCDULYEDJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanethioic S-acid?
The IUPAC name of 2-ethylhexanethioic S-acid (CID 14740452) is 2-ethylhexanethioic S-acid.
What is the SMILES notation for 2-ethylhexanethioic S-acid?
The canonical SMILES for 2-ethylhexanethioic S-acid is CCCCC(CC)C(=O)S.
What is the InChIKey of 2-ethylhexanethioic S-acid?
The InChIKey is BUOQFXCDULYEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-ethylhexanethioic S-acid?
2-ethylhexanethioic S-acid has a molecular weight of 160.28 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanethioic S-acid is sourced from PubChem (CID 14740452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).