About (3E)-5-amino-6-methylhepta-1,3-dien-4-ol
(3E)-5-amino-6-methylhepta-1,3-dien-4-ol (PubChem CID 147406203) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (3E)-5-amino-6-methylhepta-1,3-dien-4-ol.
Molecular Properties
| Compound Name | (3E)-5-amino-6-methylhepta-1,3-dien-4-ol |
| PubChem CID | 147406203 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3E)-5-amino-6-methylhepta-1,3-dien-4-ol |
| SMILES | C=C/C=C(/O)C(N)C(C)C |
| InChI | InChI=1S/C8H15NO/c1-4-5-7(10)8(9)6(2)3/h4-6,8,10H,1,9H2,2-3H3/b7-5+ |
| InChIKey | DPSFQPNORIXMTN-FNORWQNLSA-N |
| XLogP | 1.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-amino-6-methylhepta-1,3-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-amino-6-methylhepta-1,3-dien-4-ol?
The IUPAC name of (3E)-5-amino-6-methylhepta-1,3-dien-4-ol (CID 147406203) is (3E)-5-amino-6-methylhepta-1,3-dien-4-ol.
What is the SMILES notation for (3E)-5-amino-6-methylhepta-1,3-dien-4-ol?
The canonical SMILES for (3E)-5-amino-6-methylhepta-1,3-dien-4-ol is C=C/C=C(/O)C(N)C(C)C.
What is the InChIKey of (3E)-5-amino-6-methylhepta-1,3-dien-4-ol?
The InChIKey is DPSFQPNORIXMTN-FNORWQNLSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-5-7(10)8(9)6(2)3/h4-6,8,10H,1,9H2,2-3H3/b7-5+.
What are the key properties of (3E)-5-amino-6-methylhepta-1,3-dien-4-ol?
(3E)-5-amino-6-methylhepta-1,3-dien-4-ol has a molecular weight of 141.21 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-amino-6-methylhepta-1,3-dien-4-ol is sourced from PubChem (CID 147406203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).