C23H25F3N4O3 — CID 147407250
N-phenyl-N-[[4-[3-[2-(2,2,2-trifluoroacetyl)hydrazinyl]oxiran-2-yl]phenyl]methyl]piperidine-1-carboxamide (PubChem CID 147407250) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-phenyl-N-[[4-[3-[2-(2,2,2-trifluoroacetyl)hydrazinyl]oxiran-2-yl]phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | N-phenyl-N-[[4-[3-[2-(2,2,2-trifluoroacetyl)hydrazinyl]oxiran-2-yl]phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 147407250 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-phenyl-N-[[4-[3-[2-(2,2,2-trifluoroacetyl)hydrazinyl]oxiran-2-yl]phenyl]methyl]piperidine-1-carboxamide |
| SMILES | O=C(N1CCCCC1)N(Cc1ccc(C2OC2NNC(=O)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H25F3N4O3/c24-23(25,26)21(31)28-27-20-19(33-20)17-11-9-16(10-12-17)15-30(18-7-3-1-4-8-18)22(32)29-13-5-2-6-14-29/h1,3-4,7-12,19-20,27H,2,5-6,13-15H2,(H,28,31) |
| InChIKey | DPXGGGRQCIKTRG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|