About 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile
4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile (PubChem CID 147407266) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile |
| PubChem CID | 147407266 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2=CNC(C=O)C=C2)cc1 |
| InChI | InChI=1S/C13H10N2O/c14-7-10-1-3-11(4-2-10)12-5-6-13(9-16)15-8-12/h1-6,8-9,13,15H |
| InChIKey | DPXHMYCIZKUAJC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile?
The IUPAC name of 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile (CID 147407266) is 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile.
What is the SMILES notation for 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile?
The canonical SMILES for 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile is N#Cc1ccc(C2=CNC(C=O)C=C2)cc1.
What is the InChIKey of 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile?
The InChIKey is DPXHMYCIZKUAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c14-7-10-1-3-11(4-2-10)12-5-6-13(9-16)15-8-12/h1-6,8-9,13,15H.
What are the key properties of 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile?
4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile has a molecular weight of 210.24 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-formyl-1,2-dihydropyridin-5-yl)benzonitrile is sourced from PubChem (CID 147407266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).