About 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine
2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine (PubChem CID 147407401) has the molecular formula C8H18N4O
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine.
Molecular Properties
| Compound Name | 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine |
| PubChem CID | 147407401 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine |
| SMILES | CC(C)(C)C(=O)C(N)CN=C(N)N |
| InChI | InChI=1S/C8H18N4O/c1-8(2,3)6(13)5(9)4-12-7(10)11/h5H,4,9H2,1-3H3,(H4,10,11,12) |
| InChIKey | DPXXQRWXBJTUMY-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine?
The IUPAC name of 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine (CID 147407401) is 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine.
What is the SMILES notation for 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine?
The canonical SMILES for 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine is CC(C)(C)C(=O)C(N)CN=C(N)N.
What is the InChIKey of 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine?
The InChIKey is DPXXQRWXBJTUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O/c1-8(2,3)6(13)5(9)4-12-7(10)11/h5H,4,9H2,1-3H3,(H4,10,11,12).
What are the key properties of 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine?
2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine has a molecular weight of 186.26 g/mol, XLogP of -0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4,4-dimethyl-3-oxopentyl)guanidine is sourced from PubChem (CID 147407401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).