About hexane-1,2,6-triamine
hexane-1,2,6-triamine (PubChem CID 14741028) has the molecular formula C6H17N3
and a molecular weight of 131.22 g/mol. Its IUPAC name is hexane-1,2,6-triamine.
Molecular Properties
| Compound Name | hexane-1,2,6-triamine |
| PubChem CID | 14741028 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | hexane-1,2,6-triamine |
| SMILES | NCCCCC(N)CN |
| InChI | InChI=1S/C6H17N3/c7-4-2-1-3-6(9)5-8/h6H,1-5,7-9H2 |
| InChIKey | RPDQDBRTJIPWMJ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane-1,2,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,2,6-triamine?
The IUPAC name of hexane-1,2,6-triamine (CID 14741028) is hexane-1,2,6-triamine.
What is the SMILES notation for hexane-1,2,6-triamine?
The canonical SMILES for hexane-1,2,6-triamine is NCCCCC(N)CN.
What is the InChIKey of hexane-1,2,6-triamine?
The InChIKey is RPDQDBRTJIPWMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N3/c7-4-2-1-3-6(9)5-8/h6H,1-5,7-9H2.
What are the key properties of hexane-1,2,6-triamine?
hexane-1,2,6-triamine has a molecular weight of 131.22 g/mol, XLogP of -0.60, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,2,6-triamine is sourced from PubChem (CID 14741028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).