C15H23BN2O2 — CID 147411832
(Z)-N'-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethene-1,2-diamine (PubChem CID 147411832) has the molecular formula C15H23BN2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is (Z)-N'-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethene-1,2-diamine.
| Compound Name | (Z)-N'-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 147411832 |
| Molecular Formula | C15H23BN2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (Z)-N'-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethene-1,2-diamine |
| SMILES | CN/C=C(\N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H23BN2O2/c1-14(2)15(3,4)20-16(19-14)12-8-6-11(7-9-12)13(17)10-18-5/h6-10,18H,17H2,1-5H3/b13-10- |
| InChIKey | DQTJIDDSOIXJQD-RAXLEYEMSA-N |
| XLogP | 1.46 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|