C18H17N3O2 — CID 1474153
4-(2,6-dimethylphenoxy)-5-methoxy-2-pyridin-2-ylpyrimidine (PubChem CID 1474153) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-5-methoxy-2-pyridin-2-ylpyrimidine.
| Compound Name | 4-(2,6-dimethylphenoxy)-5-methoxy-2-pyridin-2-ylpyrimidine |
|---|---|
| PubChem CID | 1474153 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-5-methoxy-2-pyridin-2-ylpyrimidine |
| SMILES | COc1cnc(-c2ccccn2)nc1Oc1c(C)cccc1C |
| InChI | InChI=1S/C18H17N3O2/c1-12-7-6-8-13(2)16(12)23-18-15(22-3)11-20-17(21-18)14-9-4-5-10-19-14/h4-11H,1-3H3 |
| InChIKey | LTVKLRHBVSLSPX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |