About dipropylcarbamic acid;N-propylpropan-1-amine
dipropylcarbamic acid;N-propylpropan-1-amine (PubChem CID 14741618) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is dipropylcarbamic acid;N-propylpropan-1-amine.
Molecular Properties
| Compound Name | dipropylcarbamic acid;N-propylpropan-1-amine |
| PubChem CID | 14741618 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | dipropylcarbamic acid;N-propylpropan-1-amine |
| SMILES | CCCN(CCC)C(=O)O.CCCNCCC |
| InChI | InChI=1S/C7H15NO2.C6H15N/c1-3-5-8(6-4-2)7(9)10;1-3-5-7-6-4-2/h3-6H2,1-2H3,(H,9,10);7H,3-6H2,1-2H3 |
| InChIKey | BCBPBFFCZQHEMA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dipropylcarbamic acid;N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropylcarbamic acid;N-propylpropan-1-amine?
The IUPAC name of dipropylcarbamic acid;N-propylpropan-1-amine (CID 14741618) is dipropylcarbamic acid;N-propylpropan-1-amine.
What is the SMILES notation for dipropylcarbamic acid;N-propylpropan-1-amine?
The canonical SMILES for dipropylcarbamic acid;N-propylpropan-1-amine is CCCN(CCC)C(=O)O.CCCNCCC.
What is the InChIKey of dipropylcarbamic acid;N-propylpropan-1-amine?
The InChIKey is BCBPBFFCZQHEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C6H15N/c1-3-5-8(6-4-2)7(9)10;1-3-5-7-6-4-2/h3-6H2,1-2H3,(H,9,10);7H,3-6H2,1-2H3.
What are the key properties of dipropylcarbamic acid;N-propylpropan-1-amine?
dipropylcarbamic acid;N-propylpropan-1-amine has a molecular weight of 246.39 g/mol, XLogP of 3.18, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipropylcarbamic acid;N-propylpropan-1-amine is sourced from PubChem (CID 14741618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).