About (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one
(3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one (PubChem CID 147416214) has the molecular formula C19H16ClF2NO3
and a molecular weight of 379.79 g/mol. Its IUPAC name is (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one |
| PubChem CID | 147416214 |
| Molecular Formula | C19H16ClF2NO3 |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one |
| SMILES | O=C(CCc1ccc(F)c(Cl)c1F)[C@@]1(O)CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H16ClF2NO3/c20-16-14(21)8-6-12(17(16)22)7-9-15(24)19(26)10-11-23(18(19)25)13-4-2-1-3-5-13/h1-6,8,26H,7,9-11H2/t19-/m0/s1 |
| InChIKey | DROSZIOVPBJOJO-IBGZPJMESA-N |
| XLogP | 3.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one?
The IUPAC name of (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one (CID 147416214) is (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one.
What is the SMILES notation for (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one?
The canonical SMILES for (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one is O=C(CCc1ccc(F)c(Cl)c1F)[C@@]1(O)CCN(c2ccccc2)C1=O.
What is the InChIKey of (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one?
The InChIKey is DROSZIOVPBJOJO-IBGZPJMESA-N. The full InChI is InChI=1S/C19H16ClF2NO3/c20-16-14(21)8-6-12(17(16)22)7-9-15(24)19(26)10-11-23(18(19)25)13-4-2-1-3-5-13/h1-6,8,26H,7,9-11H2/t19-/m0/s1.
What are the key properties of (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one?
(3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one has a molecular weight of 379.79 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[3-(3-chloro-2,4-difluorophenyl)propanoyl]-3-hydroxy-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 147416214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).