C28H33NO — CID 14741654
N-[2-(2-benzhydrylphenyl)-2-methylpropyl]-2,2-dimethylpropanamide (PubChem CID 14741654) has the molecular formula C28H33NO and a molecular weight of 399.58 g/mol. Its IUPAC name is N-[2-(2-benzhydrylphenyl)-2-methylpropyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(2-benzhydrylphenyl)-2-methylpropyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 14741654 |
| Molecular Formula | C28H33NO |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-[2-(2-benzhydrylphenyl)-2-methylpropyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC(C)(C)c1ccccc1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO/c1-27(2,3)26(30)29-20-28(4,5)24-19-13-12-18-23(24)25(21-14-8-6-9-15-21)22-16-10-7-11-17-22/h6-19,25H,20H2,1-5H3,(H,29,30) |
| InChIKey | BRSMMODEYUCLOM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|