C14H20O4 — CID 147417201
methyl (Z)-3-[(1S,6R)-1,2,6-trimethyl-4-oxocyclohex-2-en-1-yl]oxybut-2-enoate (PubChem CID 147417201) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl (Z)-3-[(1S,6R)-1,2,6-trimethyl-4-oxocyclohex-2-en-1-yl]oxybut-2-enoate.
| Compound Name | methyl (Z)-3-[(1S,6R)-1,2,6-trimethyl-4-oxocyclohex-2-en-1-yl]oxybut-2-enoate |
|---|---|
| PubChem CID | 147417201 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl (Z)-3-[(1S,6R)-1,2,6-trimethyl-4-oxocyclohex-2-en-1-yl]oxybut-2-enoate |
| SMILES | COC(=O)/C=C(/C)O[C@]1(C)C(C)=CC(=O)C[C@H]1C |
| InChI | InChI=1S/C14H20O4/c1-9-6-12(15)7-10(2)14(9,4)18-11(3)8-13(16)17-5/h6,8,10H,7H2,1-5H3/b11-8-/t10-,14-/m1/s1 |
| InChIKey | DRTOAYDPTOWZED-NHZFOBQQSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|