C22H28N4OS — CID 147418935
2-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]-1-(5-pentylpyrazin-2-yl)ethanone (PubChem CID 147418935) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]-1-(5-pentylpyrazin-2-yl)ethanone.
| Compound Name | 2-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]-1-(5-pentylpyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 147418935 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[3-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)phenyl]-1-(5-pentylpyrazin-2-yl)ethanone |
| SMILES | CCCCCc1cnc(C(=O)Cc2cccc(C3(C)CCSC(N)=N3)c2)cn1 |
| InChI | InChI=1S/C22H28N4OS/c1-3-4-5-9-18-14-25-19(15-24-18)20(27)13-16-7-6-8-17(12-16)22(2)10-11-28-21(23)26-22/h6-8,12,14-15H,3-5,9-11,13H2,1-2H3,(H2,23,26) |
| InChIKey | DSBWRRIFSJRMCC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|