About CID 147423220
CID 147423220 (PubChem CID 147423220) has the molecular formula C14H16NY-
and a molecular weight of 287.19 g/mol.
Molecular Properties
| Compound Name | CID 147423220 |
| PubChem CID | 147423220 |
| Molecular Formula | C14H16NY- |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | — |
| SMILES | C/N=C1/[C@@H]2CC[C@H]1Cc1cc[c-]cc1C2.[Y] |
| InChI | InChI=1S/C14H16N.Y/c1-15-14-12-6-7-13(14)9-11-5-3-2-4-10(11)8-12;/h2,4-5,12-13H,6-9H2,1H3;/q-1;/b15-14+;/t12-,13+;/m0./s1 |
| InChIKey | HXENMSVEPAPVJK-FDYVMJLQSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 147423220 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147423220?
The IUPAC name of CID 147423220 (CID 147423220) is not available.
What is the SMILES notation for CID 147423220?
The canonical SMILES for CID 147423220 is C/N=C1/[C@@H]2CC[C@H]1Cc1cc[c-]cc1C2.[Y].
What is the InChIKey of CID 147423220?
The InChIKey is HXENMSVEPAPVJK-FDYVMJLQSA-N. The full InChI is InChI=1S/C14H16N.Y/c1-15-14-12-6-7-13(14)9-11-5-3-2-4-10(11)8-12;/h2,4-5,12-13H,6-9H2,1H3;/q-1;/b15-14+;/t12-,13+;/m0./s1.
What are the key properties of CID 147423220?
CID 147423220 has a molecular weight of 287.19 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147423220 is sourced from PubChem (CID 147423220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).