C8H15NO2 — CID 14742430
5-butan-2-yl-4-methyl-1,3-oxazolidin-2-one (PubChem CID 14742430) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 5-butan-2-yl-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 5-butan-2-yl-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14742430 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 5-butan-2-yl-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CCC(C)C1OC(=O)NC1C |
| InChI | InChI=1S/C8H15NO2/c1-4-5(2)7-6(3)9-8(10)11-7/h5-7H,4H2,1-3H3,(H,9,10) |
| InChIKey | NCGYUHWOSYCZNF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |