About [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate
[(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate (PubChem CID 147425515) has the molecular formula C8H11N3O5S
and a molecular weight of 261.26 g/mol. Its IUPAC name is [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate.
Molecular Properties
| Compound Name | [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate |
| PubChem CID | 147425515 |
| Molecular Formula | C8H11N3O5S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate |
| SMILES | [C-]#[N+][C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)OC |
| InChI | InChI=1S/C8H11N3O5S/c1-9-7-4-3-6-5-10(7)8(12)11(6)16-17(13,14)15-2/h6-7H,3-5H2,2H3/t6-,7+/m1/s1 |
| InChIKey | DTHXIIQYJSPMIV-RQJHMYQMSA-N |
| XLogP | -0.05 |
| TPSA | 80.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate?
The IUPAC name of [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate (CID 147425515) is [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate.
What is the SMILES notation for [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate?
The canonical SMILES for [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate is [C-]#[N+][C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)OC.
What is the InChIKey of [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate?
The InChIKey is DTHXIIQYJSPMIV-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H11N3O5S/c1-9-7-4-3-6-5-10(7)8(12)11(6)16-17(13,14)15-2/h6-7H,3-5H2,2H3/t6-,7+/m1/s1.
What are the key properties of [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate?
[(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate has a molecular weight of 261.26 g/mol, XLogP of -0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] methyl sulfate is sourced from PubChem (CID 147425515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).