About 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine
5-piperazin-2-yl-1,2,4-oxadiazol-3-amine (PubChem CID 14742609) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine |
| PubChem CID | 14742609 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(C2CNCCN2)n1 |
| InChI | InChI=1S/C6H11N5O/c7-6-10-5(12-11-6)4-3-8-1-2-9-4/h4,8-9H,1-3H2,(H2,7,11) |
| InChIKey | PZNDFGOGQSGMPH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine (CID 14742609) is 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine is Nc1noc(C2CNCCN2)n1.
What is the InChIKey of 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine?
The InChIKey is PZNDFGOGQSGMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O/c7-6-10-5(12-11-6)4-3-8-1-2-9-4/h4,8-9H,1-3H2,(H2,7,11).
What are the key properties of 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine?
5-piperazin-2-yl-1,2,4-oxadiazol-3-amine has a molecular weight of 169.19 g/mol, XLogP of -1.11, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperazin-2-yl-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 14742609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).