About 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine
5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 14742615) has the molecular formula C7H13N5O
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine |
| PubChem CID | 14742615 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | CN1CCNC(c2nc(N)no2)C1 |
| InChI | InChI=1S/C7H13N5O/c1-12-3-2-9-5(4-12)6-10-7(8)11-13-6/h5,9H,2-4H2,1H3,(H2,8,11) |
| InChIKey | ROFSTXSFCWTGMG-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine (CID 14742615) is 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine is CN1CCNC(c2nc(N)no2)C1.
What is the InChIKey of 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine?
The InChIKey is ROFSTXSFCWTGMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5O/c1-12-3-2-9-5(4-12)6-10-7(8)11-13-6/h5,9H,2-4H2,1H3,(H2,8,11).
What are the key properties of 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine?
5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine has a molecular weight of 183.21 g/mol, XLogP of -0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylpiperazin-2-yl)-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 14742615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).