C22H33ClN5O8P — CID 147426217
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(cyclopropylmethoxy)propan-2-yl]phosphonic acid (PubChem CID 147426217) has the molecular formula C22H33ClN5O8P and a molecular weight of 561.96 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(cyclopropylmethoxy)propan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(cyclopropylmethoxy)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 147426217 |
| Molecular Formula | C22H33ClN5O8P |
| Molecular Weight | 561.96 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(cyclopropylmethoxy)propan-2-yl]phosphonic acid |
| SMILES | CC(COCC1CC1)(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C22H33ClN5O8P/c1-22(37(31,32)33,11-34-9-12-6-7-12)35-10-15-16(29)17(30)20(36-15)28-19-14(8-24-28)18(26-21(23)27-19)25-13-4-2-3-5-13/h8,12-13,15-17,20,29-30H,2-7,9-11H2,1H3,(H,25,26,27)(H2,31,32,33)/t15-,16-,17-,20-,22?/m1/s1 |
| InChIKey | DTLDNBZCPAPLBO-WTCXSHEFSA-N |
| XLogP | 1.79 |
| TPSA | 181.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.96 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|