C20H31ClFN3O4S — CID 147429882
N-[(3S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2-thiazolidine-5-carboxamide (PubChem CID 147429882) has the molecular formula C20H31ClFN3O4S and a molecular weight of 464.00 g/mol. Its IUPAC name is N-[(3S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2-thiazolidine-5-carboxamide.
| Compound Name | N-[(3S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2-thiazolidine-5-carboxamide |
|---|---|
| PubChem CID | 147429882 |
| Molecular Formula | C20H31ClFN3O4S |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[(3S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2-thiazolidine-5-carboxamide |
| SMILES | O=C(COC1CCC(Cl)C(F)C1)NC12CCC(NC(=O)C3CCNS3)(CC1)C[C@@H]2O |
| InChI | InChI=1S/C20H31ClFN3O4S/c21-13-2-1-12(9-14(13)22)29-11-17(27)24-20-6-4-19(5-7-20,10-16(20)26)25-18(28)15-3-8-23-30-15/h12-16,23,26H,1-11H2,(H,24,27)(H,25,28)/t12?,13?,14?,15?,16-,19?,20?/m0/s1 |
| InChIKey | XQNIBCUDHGMEFX-SVOXAXPJSA-N |
| XLogP | 1.56 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|