About 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole
3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole (PubChem CID 1474300) has the molecular formula C16H10FN3O
and a molecular weight of 279.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole |
| PubChem CID | 1474300 |
| Molecular Formula | C16H10FN3O |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole |
| SMILES | Fc1ccc(-c2onc3ccc(-c4ccn[nH]4)cc23)cc1 |
| InChI | InChI=1S/C16H10FN3O/c17-12-4-1-10(2-5-12)16-13-9-11(14-7-8-18-19-14)3-6-15(13)20-21-16/h1-9H,(H,18,19) |
| InChIKey | CJZJMJOIVKUBPP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole?
The IUPAC name of 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole (CID 1474300) is 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole.
What is the SMILES notation for 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole?
The canonical SMILES for 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole is Fc1ccc(-c2onc3ccc(-c4ccn[nH]4)cc23)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole?
The InChIKey is CJZJMJOIVKUBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN3O/c17-12-4-1-10(2-5-12)16-13-9-11(14-7-8-18-19-14)3-6-15(13)20-21-16/h1-9H,(H,18,19).
What are the key properties of 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole?
3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole has a molecular weight of 279.27 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-2,1-benzoxazole is sourced from PubChem (CID 1474300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).