C25H19BrCl2F9NO2 — CID 147432130
4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide (PubChem CID 147432130) has the molecular formula C25H19BrCl2F9NO2 and a molecular weight of 687.22 g/mol. Its IUPAC name is 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide.
| Compound Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 147432130 |
| Molecular Formula | C25H19BrCl2F9NO2 |
| Molecular Weight | 687.22 g/mol |
| Exact Mass | 684.98 |
| IUPAC Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide |
| SMILES | C[C@H](CC(=O)CCC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Br)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H19BrCl2F9NO2/c1-12(8-15(39)6-7-23(29,30)31)38-22(40)16-4-2-13(9-18(16)25(35,36)37)3-5-17(24(32,33)34)14-10-19(27)21(26)20(28)11-14/h2-5,9-12,17H,6-8H2,1H3,(H,38,40)/b5-3+/t12-,17?/m1/s1 |
| InChIKey | DUNYRFUZCYDPHE-LKRDJMSLSA-N |
| XLogP | 9.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.22 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|