C16H14O7 — CID 147432938
(2S)-5,7-dihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 147432938) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is (2S)-5,7-dihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-5,7-dihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 147432938 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (2S)-5,7-dihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1c(O)cc(O)c2c1O[C@H](c1cc(O)c(O)c(O)c1)CC2=O |
| InChI | InChI=1S/C16H14O7/c1-6-8(17)4-9(18)14-10(19)5-13(23-16(6)14)7-2-11(20)15(22)12(21)3-7/h2-4,13,17-18,20-22H,5H2,1H3/t13-/m0/s1 |
| InChIKey | DUSAVYKOEJMUST-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|