C30H19F3N6O — CID 147434139
N-[3-(benzimidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide (PubChem CID 147434139) has the molecular formula C30H19F3N6O and a molecular weight of 536.52 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide.
| Compound Name | N-[3-(benzimidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 147434139 |
| Molecular Formula | C30H19F3N6O |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(-n3cnc4ccccc43)cc(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C30H19F3N6O/c1-19-8-9-21(13-20(19)10-11-24-17-34-28-7-4-12-36-39(24)28)29(40)37-23-14-22(30(31,32)33)15-25(16-23)38-18-35-26-5-2-3-6-27(26)38/h2-9,12-18H,1H3,(H,37,40) |
| InChIKey | DUXRORPYFPYESF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|