About 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide
5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide (PubChem CID 147438080) has the molecular formula C12H16F2N4O2
and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide |
| PubChem CID | 147438080 |
| Molecular Formula | C12H16F2N4O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide |
| SMILES | CCNC(=O)c1ncc(C(=O)N2CC(F)(F)C[C@@H]2C)[nH]1 |
| InChI | InChI=1S/C12H16F2N4O2/c1-3-15-10(19)9-16-5-8(17-9)11(20)18-6-12(13,14)4-7(18)2/h5,7H,3-4,6H2,1-2H3,(H,15,19)(H,16,17)/t7-/m0/s1 |
| InChIKey | DVRFGTAAMSJHJI-ZETCQYMHSA-N |
| XLogP | 1.03 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide?
The IUPAC name of 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide (CID 147438080) is 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide.
What is the SMILES notation for 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide?
The canonical SMILES for 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide is CCNC(=O)c1ncc(C(=O)N2CC(F)(F)C[C@@H]2C)[nH]1.
What is the InChIKey of 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide?
The InChIKey is DVRFGTAAMSJHJI-ZETCQYMHSA-N. The full InChI is InChI=1S/C12H16F2N4O2/c1-3-15-10(19)9-16-5-8(17-9)11(20)18-6-12(13,14)4-7(18)2/h5,7H,3-4,6H2,1-2H3,(H,15,19)(H,16,17)/t7-/m0/s1.
What are the key properties of 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide?
5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide has a molecular weight of 286.28 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-4,4-difluoro-2-methylpyrrolidine-1-carbonyl]-N-ethyl-1H-imidazole-2-carboxamide is sourced from PubChem (CID 147438080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).