About 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione
2-(4-chlorophenyl)-1,3-benzothiazine-4-thione (PubChem CID 14743827) has the molecular formula C14H8ClNS2
and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione |
| PubChem CID | 14743827 |
| Molecular Formula | C14H8ClNS2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione |
| SMILES | S=c1nc(-c2ccc(Cl)cc2)sc2ccccc12 |
| InChI | InChI=1S/C14H8ClNS2/c15-10-7-5-9(6-8-10)14-16-13(17)11-3-1-2-4-12(11)18-14/h1-8H |
| InChIKey | LTWCMHIRTDTJFH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione?
The IUPAC name of 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione (CID 14743827) is 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione.
What is the SMILES notation for 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione?
The canonical SMILES for 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione is S=c1nc(-c2ccc(Cl)cc2)sc2ccccc12.
What is the InChIKey of 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione?
The InChIKey is LTWCMHIRTDTJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClNS2/c15-10-7-5-9(6-8-10)14-16-13(17)11-3-1-2-4-12(11)18-14/h1-8H.
What are the key properties of 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione?
2-(4-chlorophenyl)-1,3-benzothiazine-4-thione has a molecular weight of 289.81 g/mol, XLogP of 5.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1,3-benzothiazine-4-thione is sourced from PubChem (CID 14743827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).