About 5-methyl-4-methylidene-1,5-dihydropyrazole
5-methyl-4-methylidene-1,5-dihydropyrazole (PubChem CID 147441004) has the molecular formula C5H8N2
and a molecular weight of 96.13 g/mol. Its IUPAC name is 5-methyl-4-methylidene-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 5-methyl-4-methylidene-1,5-dihydropyrazole |
| PubChem CID | 147441004 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | 5-methyl-4-methylidene-1,5-dihydropyrazole |
| SMILES | C=C1C=NNC1C |
| InChI | InChI=1S/C5H8N2/c1-4-3-6-7-5(4)2/h3,5,7H,1H2,2H3 |
| InChIKey | DWFKOCSSUGPFDF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4-methylidene-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-methylidene-1,5-dihydropyrazole?
The IUPAC name of 5-methyl-4-methylidene-1,5-dihydropyrazole (CID 147441004) is 5-methyl-4-methylidene-1,5-dihydropyrazole.
What is the SMILES notation for 5-methyl-4-methylidene-1,5-dihydropyrazole?
The canonical SMILES for 5-methyl-4-methylidene-1,5-dihydropyrazole is C=C1C=NNC1C.
What is the InChIKey of 5-methyl-4-methylidene-1,5-dihydropyrazole?
The InChIKey is DWFKOCSSUGPFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2/c1-4-3-6-7-5(4)2/h3,5,7H,1H2,2H3.
What are the key properties of 5-methyl-4-methylidene-1,5-dihydropyrazole?
5-methyl-4-methylidene-1,5-dihydropyrazole has a molecular weight of 96.13 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-methylidene-1,5-dihydropyrazole is sourced from PubChem (CID 147441004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).