About 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile
3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile (PubChem CID 14744158) has the molecular formula C22H13N3O2
and a molecular weight of 351.37 g/mol. Its IUPAC name is 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile.
Molecular Properties
| Compound Name | 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile |
| PubChem CID | 14744158 |
| Molecular Formula | C22H13N3O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)c(C#N)c3c2C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H13N3O2/c1-27-13-8-6-12(7-9-13)18-16(10-23)21(25)17(11-24)19-14-4-2-3-5-15(14)22(26)20(18)19/h2-9H,25H2,1H3 |
| InChIKey | FVAWCOCEZKKCRQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile?
The IUPAC name of 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile (CID 14744158) is 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile.
What is the SMILES notation for 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile?
The canonical SMILES for 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile is COc1ccc(-c2c(C#N)c(N)c(C#N)c3c2C(=O)c2ccccc2-3)cc1.
What is the InChIKey of 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile?
The InChIKey is FVAWCOCEZKKCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13N3O2/c1-27-13-8-6-12(7-9-13)18-16(10-23)21(25)17(11-24)19-14-4-2-3-5-15(14)22(26)20(18)19/h2-9H,25H2,1H3.
What are the key properties of 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile?
3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile has a molecular weight of 351.37 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(4-methoxyphenyl)-9-oxofluorene-2,4-dicarbonitrile is sourced from PubChem (CID 14744158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).