C24H25N3O3 — CID 147449748
4-[4-[2-hydroxyethyl(propanoyl)amino]phenyl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 147449748) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 4-[4-[2-hydroxyethyl(propanoyl)amino]phenyl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[4-[2-hydroxyethyl(propanoyl)amino]phenyl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 147449748 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 4-[4-[2-hydroxyethyl(propanoyl)amino]phenyl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCC(=O)N(CCO)c1ccc(-c2ccc(C(=O)NCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-2-23(29)27(14-15-28)22-11-9-20(10-12-22)19-5-7-21(8-6-19)24(30)26-17-18-4-3-13-25-16-18/h3-13,16,28H,2,14-15,17H2,1H3,(H,26,30) |
| InChIKey | DXVFBZSBNSZWQV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |