About (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one
(4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 1474501) has the molecular formula C16H12Cl2O
and a molecular weight of 291.18 g/mol. Its IUPAC name is (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 1474501 |
| Molecular Formula | C16H12Cl2O |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C16H12Cl2O/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11H,6,8H2/t11-/m0/s1 |
| InChIKey | JGMBHJNMQVKDMW-NSHDSACASA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one (CID 1474501) is (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one is O=C1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.
What is the InChIKey of (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is JGMBHJNMQVKDMW-NSHDSACASA-N. The full InChI is InChI=1S/C16H12Cl2O/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11H,6,8H2/t11-/m0/s1.
What are the key properties of (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one?
(4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 291.18 g/mol, XLogP of 5.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 1474501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).