C12H24N4O2 — CID 14745324
3-hydrazinyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide (PubChem CID 14745324) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-hydrazinyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide.
| Compound Name | 3-hydrazinyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 14745324 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-hydrazinyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
| SMILES | CC1(C)CC(NC(=O)CC(=O)NN)CC(C)(C)N1 |
| InChI | InChI=1S/C12H24N4O2/c1-11(2)6-8(7-12(3,4)16-11)14-9(17)5-10(18)15-13/h8,16H,5-7,13H2,1-4H3,(H,14,17)(H,15,18) |
| InChIKey | JXGRKHLDXYENKF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|